Description
| Crystal Violet | |
| Indicator, Pure | |
| C25H30ClN3 | |
| 13, 756 | |
| Basic Violet 3, C.I. 42555, Gentian Violet | |
| ZXJXZNDDNMQXFV-UHFFFAOYSA-M | |
| [4-[bis[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;chloride | |
| 11057 | |
| 407.99 | |
| Glass bottle |
| 215.0°C | |
| 548-62-9,90-94-8 | |
| MFCD00011750 | |
| 15, 4430 | |
| Solubility in water: 16g/L (25°C). Other solubilities: soluble in chloroform, 1 g/10 mL alcohol, 1 g/15 mL glycerin, practically insoluble in ether | |
| CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-] | |
| 407.986 | |
| CHEBI:41688 | |
| Pure | |
| 25 g |
Related Products
2.5LT Diethyl ether,certified AR 10785901
Diethyl Ether, Certified AR for Analysis, Stabilised with BHT, meets analytical specification of Ph.Eur, Fisher Chemical™
Reviews
There are no reviews yet.